≥98%(CP),≥98 atom% D for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Protected from light Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Ethanolamine-d4 (ETA-d4) is the deuterium labeled Ethanolamine (HY-Y0524). Ethanolamine is an organic chemical, which is an important pharmaceutical intermediate.
| Pubchem Sid | 528769510 |
|---|---|
| Kanonisches Lächeln | C(CO)N |
| IUPAC Name | 2-amino-1,1,2,2-tetradeuterioethanol |
| InChIKey | HZAXFHJVJLSVMW-LNLMKGTHSA-N |
| INCHI | 1S/C2H7NO/c3-1-2-4/h4H,1-3H2/i1D2,2D2 |
| Isomere SMILES | [2H]C([2H])(C([2H])([2H])O)N |
| Alternative CAS-Nummer | 141-43-5（unlabelled） |
| Molekulargewicht | 65.11 |
| Reaxy-Rn | 505944 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=505944&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Klasse | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Alkanolamines |
| Direct Parent | 1,2-aminoalcohols |
| Alternative Parents | Primary alcohols Monoalkylamines Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | 1,2-aminoalcohol - Organic oxygen compound - Hydrocarbon derivative - Primary amine - Primary alcohol - Organooxygen compound - Primary aliphatic amine - Alcohol - Aliphatic acyclic compound |
| Beschreibung | This compound belongs to the class of organic compounds known as 1,2-aminoalcohols. These are organic compounds containing an alkyl chain with an amine group bound to the C1 atom and an alcohol group bound to the C2 atom. |
| External Descriptors | Not available |
| Empfindlichkeit | Light sensitive；Moisture sensitive |
|---|---|
| Siedepunkt (°C) | 170 °C (lit.) |
| Schmelzpunkt (°C) | 11 °C (lit.) |
| Molekulargewicht | 65.110 g/mol |
| XLogP3 | -1.300 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 65.0779 Da |
| Monoisotopic Mass | 65.0779 Da |
| Topological Polar Surface Area | 46.300 Ų |
| Heavy Atom Count | 4 |
| Formal Charge | 0 |
| Complexity | 10.000 |
| Isotope Atom Count | 4 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
H2526283