Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Kanonisches Lächeln | C1CN(C(=O)N1)C2=NC=C(S2)[N+](=O)[O-] |
|---|---|
| IUPAC Name | 1-(5-nitro-1,3-thiazol-2-yl)imidazolidin-2-one |
| InChIKey | RDXLYGJSWZYTFJ-UHFFFAOYSA-N |
| INCHI | 1S/C6H6N4O3S/c11-5-7-1-2-9(5)6-8-3-4(14-6)10(12)13/h3H,1-2H2,(H,7,11) |
| Isomere SMILES | C1CN(C(=O)N1)C2=NC=C(S2)[N+](=O)[O-] |
| Alternative CAS-Nummer | 61-57-4 |
| PubChem CID | 6093 |
| NSC-Nummer | 136947 |
| MeSH-Eintrag | Ambilar;Ambilhar;BA, CIBA 32.644;CIBA 32.644 BA;Niridazole |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Klasse | Azoles |
| Subclass | Thiazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Nitrothiazoles |
| Alternative Parents | Nitroaromatic compounds 2,5-disubstituted thiazoles Imidazolidinones Heteroaromatic compounds Ureas Propargyl-type 1,3-dipolar organic compounds Organic oxoazanium compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Nitroaromatic compound - Nitrothiazole - 2,5-disubstituted 1,3-thiazole - Imidazolidinone - Imidazolidine - Heteroaromatic compound - C-nitro compound - Carbonic acid derivative - Organic nitro compound - Urea - Azacycle - Organic oxoazanium - Organic 1,3-dipolar compound - Allyl-type 1,3-dipolar organic compound - Propargyl-type 1,3-dipolar organic compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organonitrogen compound - Organooxygen compound - Carbonyl group - Organic oxygen compound - Organopnictogen compound - Aromatic heteromonocyclic compound |
| Beschreibung | This compound belongs to the class of organic compounds known as nitrothiazoles. These are compounds containing a thiazole ring which bears a nitro group. |
| External Descriptors | C-nitro compound - thiazoles |
| Molekulargewicht | 214.200 g/mol |
|---|---|
| XLogP3 | 0.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 214.016 Da |
| Monoisotopic Mass | 214.016 Da |
| Topological Polar Surface Area | 119.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 268.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |