Determine the necessary mass, volume, or concentration for preparing a solution.
10mM in DMSO for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -80°C Ships Dry ice packs + Cold packs Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Information
Rbin-1 Rbin-1 (Ribozinoindole-1) is a potent chemical inhibitor of eukaryotic ribosome assembly . It inhibits recombinant full-length Mdn1's ATPase activity in vitro.
Targets
Mdn1
In vitro
Ribozinoindoles are potent chemical inhibitors of eukaryotic ribosome assembly. Rbin-1 targets Mdn1 or cellular processes that involve this protein. It efficiently inhibit the growth of yeast cells.
| ALogP | 3.83 |
|---|---|
| HBD-Zahl | 1 |
| Rotationsfähige Bindung | 3 |
| Pubchem Sid | 528766933 |
|---|---|
| Kanonisches Lächeln | CC(=C)CSC1=NC2=C(C3=CC=CC=C3N2)N=N1 |
| IUPAC Name | 3-(2-methylprop-2-enylsulfanyl)-5H-[1,2,4]triazino[5,6-b]indole |
| InChIKey | LPCWHNSRTRBKBO-UHFFFAOYSA-N |
| INCHI | 1S/C13H12N4S/c1-8(2)7-18-13-15-12-11(16-17-13)9-5-3-4-6-10(9)14-12/h3-6H,1,7H2,2H3,(H,14,15,17) |
| Isomere SMILES | CC(=C)CSC1=NC2=C(C3=CC=CC=C3N2)N=N1 |
| PubChem CID | 5731061 |
| Molekulargewicht | 256.33 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Klasse | Indoles and derivatives |
| Subclass | Indoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Indoles |
| Alternative Parents | Alkylarylthioethers Benzenoids 1,2,4-triazines Pyrroles Heteroaromatic compounds Sulfenyl compounds Azacyclic compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Indole - Aryl thioether - Alkylarylthioether - Triazine - Benzenoid - 1,2,4-triazine - Pyrrole - Heteroaromatic compound - Sulfenyl compound - Thioether - Azacycle - Hydrocarbon derivative - Organosulfur compound - Organonitrogen compound - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Beschreibung | This compound belongs to the class of organic compounds known as indoles. These are compounds containing an indole moiety, which consists of pyrrole ring fused to benzene to form 2,3-benzopyrrole. |
| External Descriptors | Not available |
| DMSO (mg/ml) Maximale Löslichkeit | 23 |
|---|---|
| DMSO (mM) Maximale Löslichkeit | 89.72808489 |
| Wasser (mg/ml) Maximale Löslichkeit | <1 |
| Molekulargewicht | 256.329 g/mol |
| XLogP3 | 3.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 256.078 Da |
| Monoisotopic Mass | 256.078 Da |
| Topological Polar Surface Area | 79.800 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 322.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |