~25% in H₂O (1.68 M) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Trimethylphenylammonium hydroxide solution (TMPAH) is a quaternary ammonium compound that is commonly used as a strong base in organic synthesis. It is also used as a deprotecting agent for the removal of t-butoxycarbonyl (Boc) groups from amino acids or peptides and benzyl protecting groups from alcohols or amines.
| Pubchem Sid | 528769131 |
|---|---|
| Kanonisches Lächeln | C[N+](C)(C)C1=CC=CC=C1.[OH-] |
| IUPAC Name | trimethyl(phenyl)azanium;hydroxide |
| InChIKey | HADKRTWCOYPCPH-UHFFFAOYSA-M |
| INCHI | 1S/C9H14N.H2O/c1-10(2,3)9-7-5-4-6-8-9;/h4-8H,1-3H3;1H2/q+1;/p-1 |
| Isomere SMILES | C[N+](C)(C)C1=CC=CC=C1.[OH-] |
| WGK Deutschland | 3 |
| UN-Nummer | 3267 |
| Verpackungsgruppe | II |
| Molekulargewicht | 153.22 |
| Beilstein | 3917033 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Klasse | Benzene and substituted derivatives |
| Subclass | Aniline and substituted anilines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aniline and substituted anilines |
| Alternative Parents | Quaternary ammonium salts Organopnictogen compounds Organic salts Organic oxoanionic compounds Organic oxides Hydrocarbon derivatives Amines |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Aniline or substituted anilines - Quaternary ammonium salt - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organic salt - Organonitrogen compound - Organic hydroxide - Amine - Aromatic homomonocyclic compound |
| Beschreibung | This compound belongs to the class of organic compounds known as aniline and substituted anilines. These are organic compounds containing an aminobenzene moiety. |
| External Descriptors | quaternary ammonium salt |
| Empfindlichkeit | Air sensitive |
|---|---|
| Brechungsindex | n20/D 1.395 |
| Molekulargewicht | 153.220 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 1 |
| Exact Mass | 153.115 Da |
| Monoisotopic Mass | 153.115 Da |
| Topological Polar Surface Area | 1.000 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 95.800 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
G2530556