Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1(=C(C(=O)C(=O)C(=O)C1=O)O)O |
|---|---|
| IUPAC Name | 5,6-dihydroxycyclohex-5-ene-1,2,3,4-tetrone |
| InChIKey | WCJLIWFWHPOTAC-UHFFFAOYSA-N |
| INCHI | 1S/C6H2O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h7-8H |
| Isomeric SMILES | C1(=C(C(=O)C(=O)C(=O)C1=O)O)O |
| Alternate CAS | 118-76-3,523-21-7 (hydrochloride salt) |
| PubChem CID | 67050 |
| MeSH Entry Terms | ((3,4,5,6-tetraoxo-1-cyclohexen-1,2-ylene)dioxy) disodium;rhodizonic acid;rhodizonic acid, barium salt;rhodizonic acid, dipotassium salt;rhodizonic acid, sodium salt;sodium rhodizonate |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Ketones - Cyclic ketones - Quinones - Benzoquinones |
| Direct Parent | P-benzoquinones |
| Alternative Parents | O-benzoquinones M-benzoquinones Phenols Benzene and substituted derivatives Vinylogous acids Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | P-benzoquinone - O-benzoquinone - M-benzoquinone - Phenol - Benzenoid - Monocyclic benzene moiety - Vinylogous acid - Organic oxide - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as p-benzoquinones. These are benzoquinones where the two C=O groups are attached at the 1- and 4-positions, respectively. |
| External Descriptors | Not available |
| Molecular Weight | 170.080 g/mol |
|---|---|
| XLogP3 | -1.000 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 0 |
| Exact Mass | 169.985 Da |
| Monoisotopic Mass | 169.985 Da |
| Topological Polar Surface Area | 109.000 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 313.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |