Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CCOC(=O)C1=C(C2=CN=CN=C2O1)O |
|---|---|
| IUPAC Name | ethyl 5-hydroxyfuro[2,3-d]pyrimidine-6-carboxylate |
| InChIKey | MJXBCAKBWTXYNI-UHFFFAOYSA-N |
| INCHI | 1S/C9H8N2O4/c1-2-14-9(13)7-6(12)5-3-10-4-11-8(5)15-7/h3-4,12H,2H2,1H3 |
| Molecular Weight | 208.17 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Furans |
| Subclass | Furoic acid and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Furoic acid esters |
| Alternative Parents | Furo[2,3-d]pyrimidines Pyrimidines and pyrimidine derivatives Vinylogous acids Heteroaromatic compounds Carboxylic acid esters Oxacyclic compounds Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Furoic acid ester - Furo[2,3-d]pyrimidine - Pyrimidine - Vinylogous acid - Heteroaromatic compound - Carboxylic acid ester - Carboxylic acid derivative - Azacycle - Oxacycle - Organic oxide - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Hydrocarbon derivative - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as furoic acid esters. These are ester derivatives of furoic acid. |
| External Descriptors | Not available |
| Molecular Weight | 208.170 g/mol |
|---|---|
| XLogP3 | 1.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 3 |
| Exact Mass | 208.048 Da |
| Monoisotopic Mass | 208.048 Da |
| Topological Polar Surface Area | 85.500 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 248.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |