≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504756157 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504756157 |
| Canonical Smiles | CC12CCC3C(C1CC=C2)CCC4=CC(=O)CCC34C |
| IUPAC Name | (8S,9S,10R,13R,14S)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
| InChIKey | HNDHDMOSWUAEAW-VMXHOPILSA-N |
| INCHI | 1S/C19H26O/c1-18-9-3-4-16(18)15-6-5-13-12-14(20)7-11-19(13,2)17(15)8-10-18/h3,9,12,15-17H,4-8,10-11H2,1-2H3/t15-,16-,17-,18-,19-/m0/s1 |
| Isomeric SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC=C2)CCC4=CC(=O)CC[C@]34C |
| Molecular Weight | 270.4 |
| Reaxy-Rn | 2057158 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2057158&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Steroids and steroid derivatives |
| Subclass | Androstane steroids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Androgens and derivatives |
| Alternative Parents | 3-oxosteroids Cyclohexenones Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Androgen-skeleton - Oxosteroid - 3-oxosteroid - Cyclohexenone - Cyclic ketone - Ketone - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as androgens and derivatives. These are 3-hydroxylated C19 steroid hormones. They are known to favor the development of masculine characteristics. They also show profound effects on scalp and body hair in humans. |
| External Descriptors | Not available |
| Solubility | Soluble in chloroform (~2 mg/ml), and methanol (~3 mg/ml). |
|---|---|
| Refractive Index | n20D1.56 (Predicted) |
| Flash Point(°C) | 179.213°C |
| Boil Point(°C) | ~390.3° C at 760 mmHg (Predicted) |
| Melt Point(°C) | 131-133° C |
| Molecular Weight | 270.400 g/mol |
| XLogP3 | 4.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 270.198 Da |
| Monoisotopic Mass | 270.198 Da |
| Topological Polar Surface Area | 17.100 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 514.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 5 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Haolong Li, Tianmeng Guo, Ziyi Luo, Jingying Chen, Xuewen Xie, Golam Jalal Ahammed, Airong Liu, Shuangchen Chen. (2025) Volatile organic compounds from Irpex lacteus inhibit pathogenic fungi and enhance plant resistance to Botrytis cinerea in tomato. MICROBIOLOGICAL RESEARCH, [PMID:40262356] [10.1016/j.micres.2025.128188] |
L2106215