≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488195760 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488195760 |
| Canonical Smiles | C1=CC=C(C=C1)NC2=CC=CC=C2Br |
| IUPAC Name | 2-bromo-N-phenylaniline |
| InChIKey | WAAWAHYRHUWAFM-UHFFFAOYSA-N |
| INCHI | 1S/C12H10BrN/c13-11-8-4-5-9-12(11)14-10-6-2-1-3-7-10/h1-9,14H |
| Isomeric SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2Br |
| Molecular Weight | 248.12 |
| Reaxy-Rn | 2719431 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2719431&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Aniline and substituted anilines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 2-bromoanilines |
| Alternative Parents | Bromobenzenes Primary aromatic amines Aryl bromides Secondary amines Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | 2-bromoaniline - Halobenzene - Bromobenzene - Primary aromatic amine - Aryl halide - Aryl bromide - Secondary amine - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Organobromide - Organohalogen compound - Amine - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 2-bromoanilines. These are organic compounds that contain an aniline carrying a bromine atom at the C2-position. |
| External Descriptors | Not available |
| Sensitivity | air sensitive |
|---|---|
| Refractive Index | 1.66 |
| Flash Point(°C) | 149 °C |
| Boil Point(°C) | 141 °C/3 mmHg |
| Molecular Weight | 248.120 g/mol |
| XLogP3 | 4.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 247 Da |
| Monoisotopic Mass | 247 Da |
| Topological Polar Surface Area | 12.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 166.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
C2214050