≥98 atom% D for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Wet ice (in summer) Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CC1CO1 |
|---|---|
| IUPAC Name | 2,2,3-trideuterio-3-(trideuteriomethyl)oxirane |
| InChIKey | GOOHAUXETOMSMM-LIDOUZCJSA-N |
| INCHI | 1S/C3H6O/c1-3-2-4-3/h3H,2H2,1H3/i1D3,2D2,3D |
| Isomeric SMILES | [2H]C1(C(O1)([2H])C([2H])([2H])[2H])[2H] |
| PubChem CID | 16212941 |
| UN Number | 1280 |
| Molecular Weight | 64.12 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Epoxides |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Epoxides |
| Alternative Parents | Oxacyclic compounds Dialkyl ethers Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Oxacycle - Ether - Oxirane - Dialkyl ether - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as epoxides. These are compounds containing a cyclic ether with three ring atoms(one oxygen and two carbon atoms). |
| External Descriptors | Not available |
| Refractive Index | n20/D 1.365 (lit.) |
|---|---|
| Flash Point(°F) | -34.6 °F - closed cup |
| Flash Point(°C) | -37 °C - closed cup |
| Boil Point(°C) | 34℃ (lit.) |
| Melt Point(°C) | −112℃ (lit.) |
| Molecular Weight | 64.120 g/mol |
| XLogP3 | 0.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 64.0795 Da |
| Monoisotopic Mass | 64.0795 Da |
| Topological Polar Surface Area | 12.500 Ų |
| Heavy Atom Count | 4 |
| Formal Charge | 0 |
| Complexity | 26.500 |
| Isotope Atom Count | 6 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
