Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C(#N)C1=C(SC(=C(S1)C#N)C#N)C#N |
|---|---|
| IUPAC Name | 1,4-dithiine-2,3,5,6-tetracarbonitrile |
| InChIKey | NKIPKZDOGWGPNS-UHFFFAOYSA-N |
| INCHI | 1S/C8N4S2/c9-1-5-6(2-10)14-8(4-12)7(3-11)13-5 |
| Isomeric SMILES | C(#N)C1=C(SC(=C(S1)C#N)C#N)C#N |
| PubChem CID | 551138 |
| Molecular Weight | 216.2 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Dithiins |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dithiins |
| Alternative Parents | Thioenol ethers Nitriles Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | 1,4-dithiin - Thioenolether - Nitrile - Carbonitrile - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as dithiins. These are compounds comprising a dithiin ring, which is an unsaturated six-member heterocycle containing four carbon atoms, two sulfur atoms and two double bonds. |
| External Descriptors | Not available |
| Molecular Weight | 216.200 g/mol |
|---|---|
| XLogP3 | 1.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 0 |
| Exact Mass | 215.956 Da |
| Monoisotopic Mass | 215.956 Da |
| Topological Polar Surface Area | 146.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 445.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |