Determine the necessary mass, volume, or concentration for preparing a solution.
≥98%(HPLC)(T) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CC(=O)N1CN(C(=O)NC1=O)C(=O)C |
|---|---|
| IUPAC Name | 1,5-diacetyl-1,3,5-triazinane-2,4-dione |
| InChIKey | LYPVKWMHGFMDPD-UHFFFAOYSA-N |
| INCHI | 1S/C7H9N3O4/c1-4(11)9-3-10(5(2)12)7(14)8-6(9)13/h3H2,1-2H3,(H,8,13,14) |
| Isomeric SMILES | CC(=O)N1CN(C(=O)NC1=O)C(=O)C |
| Molecular Weight | 199.17 |
| Reaxy-Rn | 883842 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=883842&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Organic carbonic acids and derivatives |
| Subclass | Ureas |
| Intermediate Tree Nodes | Ureides |
| Direct Parent | N-acyl ureas |
| Alternative Parents | 1,3,5-triazinanes Dicarboximides Acetamides Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | N-acyl urea - 1,3,5-triazinane - Triazinane - Dicarboximide - Acetamide - Azacycle - Organoheterocyclic compound - Carboxylic acid derivative - Organopnictogen compound - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Organic nitrogen compound - Carbonyl group - Hydrocarbon derivative - Organic oxide - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as n-acyl ureas. These are compounds containing an urea bearing a N-acyl group. |
| External Descriptors | Not available |
| Sensitivity | Hygroscopic |
|---|---|
| Melt Point(°C) | 214 °C |
| Molecular Weight | 199.160 g/mol |
| XLogP3 | -1.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 199.059 Da |
| Monoisotopic Mass | 199.059 Da |
| Topological Polar Surface Area | 86.800 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 295.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |