Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1C(C1(Cl)Cl)CS(=O)(=O)Cl |
|---|---|
| IUPAC Name | (2,2-dichlorocyclopropyl)methanesulfonyl chloride |
| InChIKey | RIXYDQHHAVBYAC-UHFFFAOYSA-N |
| INCHI | 1S/C4H5Cl3O2S/c5-4(6)1-3(4)2-10(7,8)9/h3H,1-2H2 |
| Isomeric SMILES | C1C(C1(Cl)Cl)CS(=O)(=O)Cl |
| PubChem CID | 45791405 |
| Molecular Weight | 223.5 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Class | Sulfonyl halides |
| Subclass | Sulfonyl chlorides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Sulfonyl chlorides |
| Alternative Parents | Sulfonyls Organosulfonic acids and derivatives Organochlorides Organic oxides Hydrocarbon derivatives Alkyl chlorides |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Sulfonyl - Sulfonyl chloride - Organosulfonic acid or derivatives - Organic sulfonic acid or derivatives - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organochloride - Alkyl halide - Alkyl chloride - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as sulfonyl chlorides. These are compounds containing a sulfonyl (R-S(=O)2-R') functional group singly bonded to a chlorine atom. |
| External Descriptors | Not available |
| Molecular Weight | 223.500 g/mol |
|---|---|
| XLogP3 | 1.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 221.908 Da |
| Monoisotopic Mass | 221.908 Da |
| Topological Polar Surface Area | 42.500 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 227.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |