≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1=C(C(=NN1CCN)C(F)(F)F)Cl |
|---|---|
| IUPAC Name | 2-[4-chloro-3-(trifluoromethyl)pyrazol-1-yl]ethanamine |
| InChIKey | KBAPRKOZXLQVFR-UHFFFAOYSA-N |
| INCHI | 1S/C6H7ClF3N3/c7-4-3-13(2-1-11)12-5(4)6(8,9)10/h3H,1-2,11H2 |
| Isomeric SMILES | C1=C(C(=NN1CCN)C(F)(F)F)Cl |
| PubChem CID | 19620742 |
| Molecular Weight | 213.59 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Primary amines |
| Direct Parent | 2-arylethylamines |
| Alternative Parents | Aryl chlorides Pyrazoles Heteroaromatic compounds Azacyclic compounds Organofluorides Organochlorides Monoalkylamines Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2-arylethylamine - Aryl chloride - Aryl halide - Heteroaromatic compound - Azole - Pyrazole - Azacycle - Organoheterocyclic compound - Organohalogen compound - Primary aliphatic amine - Alkyl halide - Alkyl fluoride - Hydrocarbon derivative - Organochloride - Organofluoride - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 2-arylethylamines. These are primary amines that have the general formula RCCNH2, where R is an organic group. |
| External Descriptors | Not available |
| Molecular Weight | 213.590 g/mol |
|---|---|
| XLogP3 | 0.800 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 2 |
| Exact Mass | 213.028 Da |
| Monoisotopic Mass | 213.028 Da |
| Topological Polar Surface Area | 43.800 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 175.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
![2-[4-chloro-3-(trifluoromethyl)-1H-pyrazol-1-yl]ethanamine - ≥97% , CAS No.1006473-61-5](https://www.aladdinsci.com/media/catalog/product/placeholder/default/default_4.jpg)