Determine the necessary mass, volume, or concentration for preparing a solution.
AVAILABLE TO ORDER
GRADE & PURITY ≥95%
Storage
Room temperature
| Canonical Smiles | CC1=CC=CC=C1[Si](C)(C)C2=CC=CC=C2CO |
|---|---|
| IUPAC Name | [2-[dimethyl-(2-methylphenyl)silyl]phenyl]methanol |
| InChIKey | VNMCFSBIGQPPOE-UHFFFAOYSA-N |
| INCHI | 1S/C16H20OSi/c1-13-8-4-6-10-15(13)18(2,3)16-11-7-5-9-14(16)12-17/h4-11,17H,12H2,1-3H3 |
| Isomeric SMILES | CC1=CC=CC=C1[Si](C)(C)C2=CC=CC=C2CO |
| PubChem CID | 11989422 |
| Molecular Weight | 256.42 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzyl alcohols |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzyl alcohols |
| Alternative Parents | Toluenes Alkylarylsilanes Organic metalloid salts Primary alcohols Hydrocarbon derivatives Aromatic alcohols Alkylsilanes |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzyl alcohol - Alkylarylsilane - Toluene - Organic metalloid salt - Organic oxygen compound - Hydrocarbon derivative - Organosilicon compound - Alkylsilane - Aromatic alcohol - Primary alcohol - Organooxygen compound - Organic metalloid moeity - Alcohol - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzyl alcohols. These are organic compounds containing the phenylmethanol substructure. |
| External Descriptors | Not available |
| Molecular Weight | 256.410 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 3 |
| Exact Mass | 256.128 Da |
| Monoisotopic Mass | 256.128 Da |
| Topological Polar Surface Area | 20.200 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 264.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |