Determine the necessary mass, volume, or concentration for preparing a solution.
AVAILABLE TO ORDER
GRADE & PURITY ≥95%
Storage
Room temperature
| Canonical Smiles | C1COC(OC1)CCC(=O)C2=CC=CC=C2C3=CC=C(C=C3)C(F)(F)F |
|---|---|
| IUPAC Name | 3-(1,3-dioxan-2-yl)-1-[2-[4-(trifluoromethyl)phenyl]phenyl]propan-1-one |
| InChIKey | FOKLBVWPPHNKCC-UHFFFAOYSA-N |
| INCHI | 1S/C20H19F3O3/c21-20(22,23)15-8-6-14(7-9-15)16-4-1-2-5-17(16)18(24)10-11-19-25-12-3-13-26-19/h1-2,4-9,19H,3,10-13H2 |
| Isomeric SMILES | C1COC(OC1)CCC(=O)C2=CC=CC=C2C3=CC=C(C=C3)C(F)(F)F |
| PubChem CID | 24727985 |
| Molecular Weight | 364.364 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Ketones - Aryl ketones - Phenylketones |
| Direct Parent | Alkyl-phenylketones |
| Alternative Parents | Biphenyls and derivatives Butyrophenones Trifluoromethylbenzenes Benzoyl derivatives Aryl alkyl ketones 1,3-dioxanes Oxacyclic compounds Acetals Organofluorides Organic oxides Hydrocarbon derivatives Alkyl fluorides Aldehydes |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Alkyl-phenylketone - Biphenyl - Butyrophenone - Trifluoromethylbenzene - Aryl alkyl ketone - Benzoyl - Meta-dioxane - Benzenoid - Monocyclic benzene moiety - Acetal - Oxacycle - Organoheterocyclic compound - Organic oxide - Organohalogen compound - Organofluoride - Alkyl halide - Alkyl fluoride - Aldehyde - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkyl-phenylketones. These are aromatic compounds containing a ketone substituted by one alkyl group, and a phenyl group. |
| External Descriptors | Not available |
| Molecular Weight | 364.400 g/mol |
|---|---|
| XLogP3 | 4.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 5 |
| Exact Mass | 364.129 Da |
| Monoisotopic Mass | 364.129 Da |
| Topological Polar Surface Area | 35.500 Ų |
| Heavy Atom Count | 26 |
| Formal Charge | 0 |
| Complexity | 452.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |