Determine the necessary mass, volume, or concentration for preparing a solution.
≥90% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | COC1=CC2=C(C=C1)C(=C3N2C=CC=C3)C#N |
|---|---|
| IUPAC Name | 3-methoxypyrido[1,2-a]indole-10-carbonitrile |
| InChIKey | XFTUIYAMZMOGOC-UHFFFAOYSA-N |
| INCHI | 1S/C14H10N2O/c1-17-10-5-6-11-12(9-15)13-4-2-3-7-16(13)14(11)8-10/h2-8H,1H3 |
| Isomeric SMILES | COC1=CC2=C(C=C1)C(=C3N2C=CC=C3)C#N |
| PubChem CID | 1488983 |
| Molecular Weight | 222.25 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrrolopyridines |
| Subclass | Indolizines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Indolizines |
| Alternative Parents | Indoles Anisoles Alkyl aryl ethers Substituted pyrroles Pyridines and derivatives Heteroaromatic compounds Nitriles Azacyclic compounds Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Indole - Indole or derivatives - Indolizine - Anisole - Alkyl aryl ether - Benzenoid - Substituted pyrrole - Pyridine - Heteroaromatic compound - Pyrrole - Ether - Azacycle - Carbonitrile - Nitrile - Organic oxygen compound - Hydrocarbon derivative - Organopnictogen compound - Organic nitrogen compound - Organonitrogen compound - Organooxygen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as indolizines. These are polycyclic compounds containing an indolizine moiety, which is characterized by the presence of a pyrrole ring fused to a pyridine(Pyrrolo[1,2-a]pyridine). |
| External Descriptors | Not available |
| Molecular Weight | 222.240 g/mol |
|---|---|
| XLogP3 | 3.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 222.079 Da |
| Monoisotopic Mass | 222.079 Da |
| Topological Polar Surface Area | 37.400 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 334.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |