Determine the necessary mass, volume, or concentration for preparing a solution.
≥90% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CC(C)N1C2=CC=CC=C2C3=C(C1=O)C(=CC(=O)O3)O |
|---|---|
| IUPAC Name | 4-hydroxy-6-propan-2-ylpyrano[3,2-c]quinoline-2,5-dione |
| InChIKey | PBBMHDQZZBVLCA-UHFFFAOYSA-N |
| INCHI | 1S/C15H13NO4/c1-8(2)16-10-6-4-3-5-9(10)14-13(15(16)19)11(17)7-12(18)20-14/h3-8,17H,1-2H3 |
| Isomeric SMILES | CC(C)N1C2=CC=CC=C2C3=C(C1=O)C(=CC(=O)O3)O |
| PubChem CID | 54687582 |
| Molecular Weight | 271.27 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Quinolines and derivatives |
| Subclass | Quinolones and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyranoquinolines |
| Alternative Parents | Hydroquinolones Pyranopyridines Hydroquinolines Pyridinones Pyranones and derivatives Benzenoids Vinylogous acids Heteroaromatic compounds Lactams Lactones Azacyclic compounds Oxacyclic compounds Organooxygen compounds Hydrocarbon derivatives Organopnictogen compounds Organonitrogen compounds Organic oxides |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pyranoquinoline - Dihydroquinolone - Dihydroquinoline - Pyranopyridine - Pyranone - Pyridinone - Benzenoid - Pyridine - Pyran - Heteroaromatic compound - Vinylogous acid - Lactam - Lactone - Oxacycle - Azacycle - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyranoquinolines. These are polycyclic compounds containing a pyran ring fused to a quinoline moiety. Quinoline or benzo[b]pyridine is a bicyclic compound that consists of benzene fused to a pyridine. |
| External Descriptors | Not available |
| Molecular Weight | 271.270 g/mol |
|---|---|
| XLogP3 | 1.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 271.084 Da |
| Monoisotopic Mass | 271.084 Da |
| Topological Polar Surface Area | 66.800 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 532.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |