Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1C2=C(N=CC=C2)OC3=CC=CC=C31 |
|---|---|
| IUPAC Name | 5H-chromeno[2,3-b]pyridine |
| InChIKey | MXIYRNSRKGMBLQ-UHFFFAOYSA-N |
| INCHI | 1S/C12H9NO/c1-2-6-11-9(4-1)8-10-5-3-7-13-12(10)14-11/h1-7H,8H2 |
| Isomeric SMILES | C1C2=C(N=CC=C2)OC3=CC=CC=C31 |
| PubChem CID | 12274207 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Benzopyrans |
| Subclass | 1-benzopyrans |
| Intermediate Tree Nodes | Chromenopyridines |
| Direct Parent | Chromeno[2,3-b]pyridines |
| Alternative Parents | Diarylethers Pyranopyridines Pyridines and derivatives Benzenoids Heteroaromatic compounds Oxacyclic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Chromeno[2,3-b]pyridine - Diaryl ether - Pyranopyridine - Pyridine - Benzenoid - Heteroaromatic compound - Ether - Oxacycle - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organopnictogen compound - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as chromeno[2,3-b]pyridines. These are aromatic heteropolycyclic compounds containing pyridine linearly fused to the pyran moiety of a benzofuran ring system. |
| External Descriptors | Not available |
| Molecular Weight | 183.210 g/mol |
|---|---|
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 183.068 Da |
| Monoisotopic Mass | 183.068 Da |
| Topological Polar Surface Area | 22.100 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 206.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |