≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1=C(N2C(=N1)C(=NC(=N2)Cl)Cl)Br |
|---|---|
| IUPAC Name | 7-bromo-2,4-dichloroimidazo[2,1-f][1,2,4]triazine |
| InChIKey | XWISIRUFGYQLSR-UHFFFAOYSA-N |
| INCHI | 1S/C5HBrCl2N4/c6-2-1-9-4-3(7)10-5(8)11-12(2)4/h1H |
| Isomeric SMILES | C1=C(N2C(=N1)C(=NC(=N2)Cl)Cl)Br |
| PubChem CID | 86708472 |
| Molecular Weight | 267.9 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Triazines |
| Subclass | 1,2,4-triazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 1,2,4-triazines |
| Alternative Parents | N-substituted imidazoles Aryl chlorides Aryl bromides Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organochlorides Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Aryl bromide - Aryl chloride - Aryl halide - 1,2,4-triazine - N-substituted imidazole - Heteroaromatic compound - Azole - Imidazole - Azacycle - Organobromide - Organochloride - Organonitrogen compound - Hydrocarbon derivative - Organic nitrogen compound - Organohalogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as 1,2,4-triazines. These are compounds containing a triazine ring, which is a heterocyclic ring, similar to the six-member benzene ring but with three carbons replaced by nitrogen atoms, at ring positions 1, 2, and 4. |
| External Descriptors | Not available |
| Molecular Weight | 267.900 g/mol |
|---|---|
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 265.876 Da |
| Monoisotopic Mass | 265.876 Da |
| Topological Polar Surface Area | 43.100 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 183.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
![7-bromo-2,4-dichloro-imidazo[2,1-f][1,2,4]triazine - ≥97% CAS No(1541253-70-6) by Aladdin Scientific](https://www.aladdinsci.com/media/catalog/product/cache/207e23213cf636ccdef205098cf3c8a3/r/e/reagent_700_B629630.jpg)