Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CC1=CC=CN2C1=NC(=NC2=O)SC |
|---|---|
| IUPAC Name | 9-methyl-2-methylsulfanylpyrido[1,2-a][1,3,5]triazin-4-one |
| InChIKey | WGAWPEDAJWIZPM-UHFFFAOYSA-N |
| INCHI | 1S/C9H9N3OS/c1-6-4-3-5-12-7(6)10-8(14-2)11-9(12)13/h3-5H,1-2H3 |
| Isomeric SMILES | CC1=CC=CN2C1=NC(=NC2=O)SC |
| PubChem CID | 2768997 |
| Molecular Weight | 207.25 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Triazines |
| Subclass | 1,3,5-triazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Methylthio-s-triazines |
| Alternative Parents | Alkyl-2-thio-S-triazines Triazinones Methylpyridines Alkylarylthioethers Heteroaromatic compounds Sulfenyl compounds Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Methylthio-s-triazine - Alkyl-2-thio-s-triazine - Aryl thioether - Triazinone - Alkylarylthioether - Methylpyridine - Pyridine - Heteroaromatic compound - Thioether - Sulfenyl compound - Azacycle - Organopnictogen compound - Organonitrogen compound - Organic oxygen compound - Organic nitrogen compound - Organosulfur compound - Organooxygen compound - Organic oxide - Hydrocarbon derivative - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as methylthio-s-triazines. These are aromatic compounds containing a 1,3,5-triazine ring that is substituted at the 2-position with a methylthio group. |
| External Descriptors | Not available |
| Molecular Weight | 207.250 g/mol |
|---|---|
| XLogP3 | 1.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 207.047 Da |
| Monoisotopic Mass | 207.047 Da |
| Topological Polar Surface Area | 70.300 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 406.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |