Determine the necessary mass, volume, or concentration for preparing a solution.
≥98%, A solution in ethanol for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
cis-7-Hexadecenoic Acid methyl ester is a complement to cis-7-hexadecenoic acid. The non-esterified molecule has been isolated from autotrophic bacterial cultures associated with the accumulation of sulfate in biofilters. This indicates they originate from a sulfide-oxidizing autotrophic organism. Has only been detected in strains of the genus|Nitrospira|, which are nitrite oxidizing autotrophic bacteria.
| Canonical Smiles | CCCCCCCCC=CCCCCCC(=O)OC |
|---|---|
| IUPAC Name | methyl (Z)-hexadec-7-enoate |
| InChIKey | FXCDESKKWMGGON-KHPPLWFESA-N |
| INCHI | 1S/C17H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19-2/h10-11H,3-9,12-16H2,1-2H3/b11-10- |
| Isomeric SMILES | CCCCCCCC/C=C\CCCCCC(=O)OC |
| WGK Germany | 1 |
| Molecular Weight | 268.43 |
| Reaxy-Rn | 9565699 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=9565699&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Subclass | Fatty acid esters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fatty acid methyl esters |
| Alternative Parents | Methyl esters Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Fatty acid methyl ester - Methyl ester - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as fatty acid methyl esters. These are compounds containing a fatty acid that is esterified with a methyl group. They have the general structure RC(=O)OR', where R=fatty aliphatic tail or organyl group and R'=methyl group. |
| External Descriptors | Wax monoesters |
| Solubility | Soluble in ethanol, DMSO (~30 mg/ml), and DMF (~30 mg/ml). Insoluble in water. |
|---|---|
| Refractive Index | n20D1.45 (Predicted) |
| Boil Point(°C) | 78° C |
| Molecular Weight | 268.400 g/mol |
| XLogP3 | 6.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 14 |
| Exact Mass | 268.24 Da |
| Monoisotopic Mass | 268.24 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 221.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 1 |
| Covalently-Bonded Unit Count | 1 |