Determine the necessary mass, volume, or concentration for preparing a solution.
10mM in DMSO for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -80°C Ships Dry ice packs + Cold packs Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 3 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CCOC(=O)C1=C(NC(=C(C1)C(=O)OCC)C)C |
|---|---|
| IUPAC Name | diethyl 2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | LJXTYJXBORAIHX-UHFFFAOYSA-N |
| INCHI | 1S/C13H19NO4/c1-5-17-12(15)10-7-11(13(16)18-6-2)9(4)14-8(10)3/h14H,5-7H2,1-4H3 |
| Isomeric SMILES | CCOC(=O)C1=C(NC(=C(C1)C(=O)OCC)C)C |
| WGK Germany | 2 |
| RTECS | US7970100 |
| Molecular Weight | 253.3 |
| Beilstein | 22(5)4,81 |
| Reaxy-Rn | 210605 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=210605&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Hydropyridines |
| Intermediate Tree Nodes | Dihydropyridines |
| Direct Parent | Dihydropyridinecarboxylic acids and derivatives |
| Alternative Parents | Dicarboxylic acids and derivatives Vinylogous amides Enoate esters Amino acids and derivatives Enamines Dialkylamines Azacyclic compounds Organopnictogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Dihydropyridinecarboxylic acid derivative - Dicarboxylic acid or derivatives - Enoate ester - Alpha,beta-unsaturated carboxylic ester - Vinylogous amide - Amino acid or derivatives - Carboxylic acid ester - Carboxylic acid derivative - Secondary aliphatic amine - Enamine - Secondary amine - Azacycle - Organic nitrogen compound - Organic oxide - Organopnictogen compound - Amine - Organic oxygen compound - Organonitrogen compound - Organooxygen compound - Carbonyl group - Hydrocarbon derivative - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as dihydropyridinecarboxylic acids and derivatives. These are compounds containing a dihydropyridine moiety bearing a carboxylic acid group. |
| External Descriptors | Not available |
| Melt Point(°C) | 183 °C |
|---|---|
| Molecular Weight | 253.290 g/mol |
| XLogP3 | 1.800 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 6 |
| Exact Mass | 253.131 Da |
| Monoisotopic Mass | 253.131 Da |
| Topological Polar Surface Area | 64.599 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 383.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Chunping Ma, Jiyin He, Yancheng Wu, Junlang Li, Jiayi Chen, Yangfan Zhang, Jinpeng Mo, Haibo Xie, Zhenguo Chi, Yang Li, Yongcan Jin. (2023) Multistimuli-responsive fluorescence behaviours of aggregation-induced emission small-molecule and electrospun nanofibre films for acid–base vapour sensing. LUMINESCENCE, 38 (10): (1720-1728). [PMID:37462124] [10.1002/bio.4558] |
| 2. Liang Wenfei, Nie Chengming, Du Jun, Han Yaoyao, Zhao Guohui, Yang Fan, Liang Guijie, Wu Kaifeng. (2023) Near-infrared photon upconversion and solar synthesis using lead-free nanocrystals. Nature Photonics, 17 (4): (346-353). [PMID:] [10.1038/s41566-023-01156-6] |
| 3. Yajun Li, Aoxiang Xu, Jili Zheng, Xianhe Deng, Can Hu, Jun Zhu, Kui Wu. (2025) Investigation of the Dissolution Behavior of Diludine in Monosolvents: Solid–Liquid Equilibrium Determination, Model Correlation, and Thermodynamic Analysis. JOURNAL OF CHEMICAL AND ENGINEERING DATA, [PMID:] [10.1021/acs.jced.5c00370] |