Determine the necessary mass, volume, or concentration for preparing a solution.
eutectic mixture of 26.5% diphenyl + 73.5% diphenyl oxide for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature,Desiccated Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1=CC=C(C=C1)C2=CC=CC=C2.C1=CC=C(C=C1)OC2=CC=CC=C2 |
|---|---|
| IUPAC Name | 1,1'-biphenyl;phenoxybenzene |
| InChIKey | MHCVCKDNQYMGEX-UHFFFAOYSA-N |
| INCHI | 1S/C12H10O.C12H10/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H;1-10H |
| Isomeric SMILES | C1=CC=C(C=C1)C2=CC=CC=C2.C1=CC=C(C=C1)OC2=CC=CC=C2 |
| Reaxy-Rn | 13213899 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=13213899&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Diphenylethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Diphenylethers |
| Alternative Parents | Biphenyls and derivatives Polyphenyl ethers Diarylethers Phenoxy compounds Phenol ethers Aromatic hydrocarbons Unsaturated hydrocarbons Hydrocarbon derivatives |
| Molecular Framework | Not available |
| Substituents | Diphenylether - Biphenyl - Polyphenyl ether - Diaryl ether - Phenoxy compound - Phenol ether - Aromatic hydrocarbon - Ether - Organic oxygen compound - Unsaturated hydrocarbon - Hydrocarbon derivative - Organooxygen compound - Hydrocarbon - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as diphenylethers. These are aromatic compounds containing two benzene rings linked to each other through an ether group. |
| External Descriptors | Not available |
| Sensitivity | heat/air/moisture sensitive |
|---|---|
| Melt Point(°C) | 12-14°C (Lit.) |
| Molecular Weight | 324.400 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 3 |
| Exact Mass | 324.151 Da |
| Monoisotopic Mass | 324.151 Da |
| Topological Polar Surface Area | 9.200 Ų |
| Heavy Atom Count | 25 |
| Formal Charge | 0 |
| Complexity | 216.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |