Determine the necessary mass, volume, or concentration for preparing a solution.
AVAILABLE TO ORDER
GRADE & PURITY ≥95%
Storage
Room temperature
| Canonical Smiles | CCOC(=O)C1=CC(=C2C=CC=CN2C1=O)[N+](=O)[O-] |
|---|---|
| IUPAC Name | ethyl 1-nitro-4-oxoquinolizine-3-carboxylate |
| InChIKey | XUAURMWEQKYGBV-UHFFFAOYSA-N |
| INCHI | 1S/C12H10N2O5/c1-2-19-12(16)8-7-10(14(17)18)9-5-3-4-6-13(9)11(8)15/h3-7H,2H2,1H3 |
| Isomeric SMILES | CCOC(=O)C1=CC(=C2C=CC=CN2C1=O)[N+](=O)[O-] |
| Alternate CAS | 1556-30-5 |
| PubChem CID | 20634152 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Quinolizines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Quinolizines |
| Alternative Parents | Pyridinecarboxylic acids Nitroaromatic compounds Pyridinones Vinylogous amides Heteroaromatic compounds Carboxylic acid esters Lactams Azacyclic compounds Propargyl-type 1,3-dipolar organic compounds Organic oxoazanium compounds Organic salts Organonitrogen compounds Hydrocarbon derivatives Organic oxides Organooxygen compounds Organic cations |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Quinolizine - Pyridine carboxylic acid or derivatives - Pyridine carboxylic acid - Nitroaromatic compound - Pyridinone - Pyridine - Heteroaromatic compound - Vinylogous amide - Carboxylic acid ester - C-nitro compound - Lactam - Organic nitro compound - Organic oxoazanium - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Allyl-type 1,3-dipolar organic compound - Carboxylic acid derivative - Azacycle - Organic nitrogen compound - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organic salt - Hydrocarbon derivative - Organic oxide - Organic cation - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as quinolizines. These are compounds containing a quinolizine moiety, which consists of two fused pyridine rings sharing a nitrogen atom. |
| External Descriptors | Not available |
| Molecular Weight | 262.220 g/mol |
|---|---|
| XLogP3 | 1.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Exact Mass | 262.059 Da |
| Monoisotopic Mass | 262.059 Da |
| Topological Polar Surface Area | 92.400 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 577.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |