Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C,Argon charged Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | COC(=O)C1=C(C(=CC(=C1)Cl)N)O |
|---|---|
| IUPAC Name | methyl 3-amino-5-chloro-2-hydroxybenzoate |
| InChIKey | YPSOMLZFAVONTN-UHFFFAOYSA-N |
| INCHI | 1S/C8H8ClNO3/c1-13-8(12)5-2-4(9)3-6(10)7(5)11/h2-3,11H,10H2,1H3 |
| Isomeric SMILES | COC(=O)C1=C(C(=CC(=C1)Cl)N)O |
| Molecular Weight | 201.61 |
| Reaxy-Rn | 2967870 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2967870&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Benzoic acid esters |
| Direct Parent | o-Hydroxybenzoic acid esters |
| Alternative Parents | Aminosalicylic acids and derivatives 3-halobenzoic acids and derivatives Aminobenzoic acids and derivatives o-Aminophenols P-chlorophenols Aniline and substituted anilines Benzoyl derivatives Chlorobenzenes Aryl chlorides Vinylogous acids Methyl esters Amino acids and derivatives Monocarboxylic acids and derivatives Organic oxides Organochlorides Organooxygen compounds Organopnictogen compounds Primary amines Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Aminosalicylic acid or derivatives - O-hydroxybenzoic acid ester - Salicylic acid or derivatives - Aminobenzoic acid or derivatives - 3-halobenzoic acid or derivatives - Halobenzoic acid or derivatives - 4-halophenol - 4-chlorophenol - O-aminophenol - Aminophenol - Benzoyl - Aniline or substituted anilines - Chlorobenzene - Phenol - Halobenzene - Aryl chloride - Aryl halide - Vinylogous acid - Methyl ester - Amino acid or derivatives - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organohalogen compound - Organooxygen compound - Primary amine - Amine - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Organochloride - Organonitrogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as o-hydroxybenzoic acid esters. These are benzoic acid esters where the benzene ring is ortho-substituted with a hydroxy group. |
| External Descriptors | Not available |
| Melt Point(°C) | 71-73℃ |
|---|---|
| Molecular Weight | 201.610 g/mol |
| XLogP3 | 1.900 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 201.019 Da |
| Monoisotopic Mass | 201.019 Da |
| Topological Polar Surface Area | 72.600 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 200.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |