Determine the necessary mass, volume, or concentration for preparing a solution.
≥95%(GC) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C[Si](C)(C[Si](C)(C)C1=CC=CC=N1)C2=CC=CC=N2 |
|---|---|
| IUPAC Name | [dimethyl(pyridin-2-yl)silyl]methyl-dimethyl-pyridin-2-ylsilane |
| InChIKey | WZXVWYFOAXHQGL-UHFFFAOYSA-N |
| INCHI | 1S/C15H22N2Si2/c1-18(2,14-9-5-7-11-16-14)13-19(3,4)15-10-6-8-12-17-15/h5-12H,13H2,1-4H3 |
| Isomeric SMILES | C[Si](C)(C[Si](C)(C)C1=CC=CC=N1)C2=CC=CC=N2 |
| Molecular Weight | 286.53 |
| Reaxy-Rn | 8320931 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=8320931&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Class | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkylarylsilanes |
| Alternative Parents | Pyridines and derivatives Heteroaromatic compounds Organic metalloid salts Azacyclic compounds Organonitrogen compounds Hydrocarbon derivatives Alkylsilanes |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Alkylarylsilane - Pyridine - Heteroaromatic compound - Azacycle - Organic metalloid salt - Organoheterocyclic compound - Organic nitrogen compound - Hydrocarbon derivative - Alkylsilane - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkylarylsilanes. These are organosilicon compounds with the general formula R[Si]R' (R = alkyl, R' = aryl). |
| External Descriptors | Not available |
| Sensitivity | Moisture sensitive |
|---|---|
| Flash Point(°C) | 171 °C |
| Molecular Weight | 286.520 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 4 |
| Exact Mass | 286.132 Da |
| Monoisotopic Mass | 286.132 Da |
| Topological Polar Surface Area | 25.800 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 264.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |