Determine the necessary mass, volume, or concentration for preparing a solution.
≥98%(N) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488200246 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488200246 |
| Kanonisches Lächeln | CCCCCC(=O)NC(C=O)C(C(C(CO)O)O)O |
| IUPAC Name | N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]hexanamide |
| InChIKey | QLZZYPWIRVQENX-LUTQBAROSA-N |
| INCHI | 1S/C12H23NO6/c1-2-3-4-5-10(17)13-8(6-14)11(18)12(19)9(16)7-15/h6,8-9,11-12,15-16,18-19H,2-5,7H2,1H3,(H,13,17)/t8-,9+,11+,12+/m0/s1 |
| Isomere SMILES | CCCCCC(=O)N[C@@H](C=O)[C@H]([C@@H]([C@@H](CO)O)O)O |
| PubChem CID | 22896151 |
| Molekulargewicht | 277.32 |
| Reaxy-Rn | 6779954 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Klasse | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Monosaccharides |
| Direct Parent | Hexoses |
| Alternative Parents | Aminosaccharides N-acyl amines Beta-hydroxy aldehydes Secondary carboxylic acid amides Secondary alcohols 1,2-diols Primary alcohols Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Hexose monosaccharide - Amino saccharide - Beta-hydroxy aldehyde - Fatty amide - Fatty acyl - N-acyl-amine - 1,2-diol - Carboxamide group - Secondary carboxylic acid amide - Secondary alcohol - Carboxylic acid derivative - Polyol - Aldehyde - Hydrocarbon derivative - Organic oxide - Alcohol - Carbonyl group - Organic nitrogen compound - Organonitrogen compound - Primary alcohol - Aliphatic acyclic compound |
| Beschreibung | This compound belongs to the class of organic compounds known as hexoses. These are monosaccharides in which the sugar unit is a is a six-carbon containing moeity. |
| External Descriptors | Not available |
| Spezifische Drehung [α] | 98° (C=1,Pyridine) |
|---|---|
| Molekulargewicht | 277.310 g/mol |
| XLogP3 | -1.500 |
| Hydrogen Bond Donor Count | 5 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 10 |
| Exact Mass | 277.153 Da |
| Monoisotopic Mass | 277.153 Da |
| Topological Polar Surface Area | 127.000 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 273.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |