Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504771114 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504771114 |
| Canonical Smiles | [B-](C[NH+]1CCCCC1)(F)(F)F |
| IUPAC Name | trifluoro(piperidin-1-ium-1-ylmethyl)boranuide |
| InChIKey | PFMNVTAJBBIDDU-UHFFFAOYSA-O |
| INCHI | 1S/C6H12BF3N/c8-7(9,10)6-11-4-2-1-3-5-11/h1-6H2/q-1/p+1 |
| Isomeric SMILES | [B-](C[NH+]1CCCCC1)(F)(F)F |
| WGK Germany | 3 |
| PubChem CID | 53243642 |
| Molecular Weight | 166.98 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidines |
| Alternative Parents | Quaternary ammonium salts Trialkylamines Boronic acid derivatives Alkylhaloboranes Organic metalloid salts Azacyclic compounds Organopnictogen compounds Monoalkylboranes Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Piperidine - Quaternary ammonium salt - Boronic acid derivative - Alkylhaloborane - Tertiary amine - Tertiary aliphatic amine - Azacycle - Organic metalloid salt - Amine - Organic nitrogen compound - Organic salt - Hydrocarbon derivative - Organopnictogen compound - Alkylborane - Monoalkylborane - Organonitrogen compound - Organic metalloid moeity - Organic cation - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidines. These are compounds containing a piperidine ring, which is a saturated aliphatic six-member ring with one nitrogen atom and five carbon atoms. |
| External Descriptors | Not available |
| Sensitivity | Hygroscopic |
|---|---|
| Melt Point(°C) | 150°C(lit.) |
| Molecular Weight | 166.980 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 167.109 Da |
| Monoisotopic Mass | 167.109 Da |
| Topological Polar Surface Area | 4.400 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 119.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |