Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | COC(=O)CNC(=O)C1CCCN1.C(=O)(C(F)(F)F)O |
|---|---|
| IUPAC Name | methyl 2-[[(2S)-pyrrolidine-2-carbonyl]amino]acetate;2,2,2-trifluoroacetic acid |
| InChIKey | QMLSRQCKLLGODS-RGMNGODLSA-N |
| INCHI | 1S/C8H14N2O3.C2HF3O2/c1-13-7(11)5-10-8(12)6-3-2-4-9-6;3-2(4,5)1(6)7/h6,9H,2-5H2,1H3,(H,10,12);(H,6,7)/t6-;/m0./s1 |
| Isomeric SMILES | COC(=O)CNC(=O)[C@@H]1CCCN1.C(=O)(C(F)(F)F)O |
| PubChem CID | 56972861 |
| Molecular Weight | 300.23 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Peptides |
| Alternative Parents | Proline and derivatives Alpha amino acid esters N-acyl-alpha amino acids and derivatives Alpha amino acid amides Pyrrolidinecarboxamides Alpha-halocarboxylic acids Methyl esters Secondary carboxylic acid amides Azacyclic compounds Carboxylic acids Dialkylamines Monocarboxylic acids and derivatives Carbonyl compounds Alkyl fluorides Organopnictogen compounds Organofluorides Hydrocarbon derivatives Organic oxides |
| Molecular Framework | Not available |
| Substituents | Alpha peptide - Alpha-amino acid ester - Proline or derivatives - N-acyl-alpha amino acid or derivatives - Alpha-amino acid amide - Alpha-amino acid or derivatives - Pyrrolidine carboxylic acid or derivatives - Pyrrolidine-2-carboxamide - Alpha-halocarboxylic acid - Alpha-halocarboxylic acid or derivatives - Methyl ester - Pyrrolidine - Amino acid or derivatives - Carboxamide group - Carboxylic acid ester - Secondary carboxylic acid amide - Secondary amine - Organoheterocyclic compound - Carboxylic acid - Azacycle - Monocarboxylic acid or derivatives - Secondary aliphatic amine - Organonitrogen compound - Organohalogen compound - Alkyl halide - Alkyl fluoride - Carbonyl group - Amine - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organooxygen compound - Organofluoride - Organic nitrogen compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as peptides. These are compounds containing an amide derived from two or more amino carboxylic acid molecules (the same or different) by formation of a covalent bond from the carbonyl carbon of one to the nitrogen atom of another. |
| External Descriptors | Not available |
| Molecular Weight | 300.230 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 9 |
| Rotatable Bond Count | 4 |
| Exact Mass | 300.093 Da |
| Monoisotopic Mass | 300.093 Da |
| Topological Polar Surface Area | 105.000 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 289.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |