Determine the necessary mass, volume, or concentration for preparing a solution.
≥96% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Description
(S)-(+)-2-(tert-Butyl)-3-methyl-4-imidazolidinone trifluoroacetic acid is a Macmillan imidazolidinone organocatalyst, which is generally employed in asymmetric transformation reactions.Highly selective organocatalyst for 1,3-dipolar addition and Friedel-Crafts alkylation.
| Canonical Smiles | CC(C)(C)C1NCC(=O)N1C.C(=O)(C(F)(F)F)O |
|---|---|
| IUPAC Name | (2S)-2-tert-butyl-3-methylimidazolidin-4-one;2,2,2-trifluoroacetic acid |
| InChIKey | HKHKOEMMPVPVOS-FJXQXJEOSA-N |
| INCHI | 1S/C8H16N2O.C2HF3O2/c1-8(2,3)7-9-5-6(11)10(7)4;3-2(4,5)1(6)7/h7,9H,5H2,1-4H3;(H,6,7)/t7-;/m0./s1 |
| Isomeric SMILES | CC(C)(C)[C@H]1NCC(=O)N1C.C(=O)(C(F)(F)F)O |
| WGK Germany | 3 |
| Molecular Weight | 270.25 |
| Reaxy-Rn | 14751518 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=14751518&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives |
| Direct Parent | Alpha amino acids and derivatives |
| Alternative Parents | Imidazolidinones Tertiary carboxylic acid amides Alpha-halocarboxylic acids Quaternary ammonium salts Tertiary amines Carboxylic acid salts Lactams Azacyclic compounds Carboxylic acids Monocarboxylic acids and derivatives Organofluorides Hydrocarbon derivatives Alkyl fluorides Carbonyl compounds Organic oxides Organic cations |
| Molecular Framework | Not available |
| Substituents | Alpha-amino acid or derivatives - Imidazolidinone - Alpha-halocarboxylic acid - Alpha-halocarboxylic acid or derivatives - Imidazolidine - Tertiary carboxylic acid amide - Quaternary ammonium salt - Carboxamide group - Carboxylic acid salt - Tertiary amine - Lactam - Azacycle - Carboxylic acid - Organoheterocyclic compound - Monocarboxylic acid or derivatives - Organooxygen compound - Alkyl halide - Alkyl fluoride - Hydrocarbon derivative - Carbonyl group - Amine - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Organohalogen compound - Organofluoride - Organonitrogen compound - Organic cation - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof. |
| External Descriptors | Not available |
| Sensitivity | Hygroscopic |
|---|---|
| Melt Point(°C) | 99-103 °C |
| Molecular Weight | 270.250 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 1 |
| Exact Mass | 270.119 Da |
| Monoisotopic Mass | 270.119 Da |
| Topological Polar Surface Area | 69.600 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 255.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |