Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CC(C)(C)[Si](C)(C)OCC1CO1 |
|---|---|
| IUPAC Name | tert-butyl-dimethyl-[[(2S)-oxiran-2-yl]methoxy]silane |
| InChIKey | YANSSVVGZPNSKD-QMMMGPOBSA-N |
| INCHI | 1S/C9H20O2Si/c1-9(2,3)12(4,5)11-7-8-6-10-8/h8H,6-7H2,1-5H3/t8-/m0/s1 |
| Isomeric SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CO1 |
| WGK Germany | 3 |
| Molecular Weight | 188.34 |
| Reaxy-Rn | 4367074 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=4367074&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Class | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Organoheterosilanes |
| Direct Parent | Trialkylheterosilanes |
| Alternative Parents | Silyl ethers Oxacyclic compounds Organic metalloid salts Epoxides Dialkyl ethers Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Trialkylheterosilane - Silyl ether - Oxacycle - Organic metalloid salt - Organoheterocyclic compound - Ether - Oxirane - Dialkyl ether - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as trialkylheterosilanes. These are organoheterosilanes, bearing a silicon atom linked to three alkyl groups and one heteroatom. |
| External Descriptors | Not available |
| Sensitivity | Moisture & Heat & Air sensitive |
|---|---|
| Refractive Index | 1.432 |
| Specific Rotation[α] | +6.5°,neat |
| Flash Point(°C) | 73 °C |
| Boil Point(°C) | 197-199°C/760mmHg |
| Molecular Weight | 188.340 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 4 |
| Exact Mass | 188.123 Da |
| Monoisotopic Mass | 188.123 Da |
| Topological Polar Surface Area | 21.800 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 160.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |