Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C,Argon charged Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504755091 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504755091 |
| Canonical Smiles | C(#N)C1(C(O1)(C#N)C#N)C#N |
| IUPAC Name | oxirane-2,2,3,3-tetracarbonitrile |
| InChIKey | YWXLYZIZWVOMML-UHFFFAOYSA-N |
| INCHI | 1S/C6N4O/c7-1-5(2-8)6(3-9,4-10)11-5 |
| Isomeric SMILES | C(#N)C1(C(O1)(C#N)C#N)C#N |
| PubChem CID | 76661 |
| UN Number | 3439 |
| Packing Group | III |
| Molecular Weight | 144.09 |
| Beilstein | 18(5)7,215 |
| Reaxy-Rn | 742766 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Epoxides |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Epoxides |
| Alternative Parents | Oxacyclic compounds Nitriles Dialkyl ethers Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Oxacycle - Nitrile - Carbonitrile - Ether - Oxirane - Dialkyl ether - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as epoxides. These are compounds containing a cyclic ether with three ring atoms(one oxygen and two carbon atoms). |
| External Descriptors | Not available |
| Solubility | Soluble in Methanol |
|---|---|
| Sensitivity | Light Sensitive,Moisture Sensitive,Heat Sensitive |
| Melt Point(°C) | 175 °C(dec.) |
| Molecular Weight | 144.090 g/mol |
| XLogP3 | -1.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 0 |
| Exact Mass | 144.007 Da |
| Monoisotopic Mass | 144.007 Da |
| Topological Polar Surface Area | 108.000 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 327.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |