Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CC(C)C[Sn](CC(C)C)(CC(C)C)CC(C)C |
|---|---|
| IUPAC Name | tetrakis(2-methylpropyl)stannane |
| InChIKey | CKPJWJGGZOJURQ-UHFFFAOYSA-N |
| INCHI | 1S/4C4H9.Sn/c4*1-4(2)3;/h4*4H,1H2,2-3H3; |
| Molecular Weight | 347.200 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Class | Organo-post-transition metal compounds |
| Subclass | Organotin compounds |
| Intermediate Tree Nodes | Tetraorganotin compounds |
| Direct Parent | Tetraalkyltins |
| Alternative Parents | Organic salts Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Tetraalkyltin - Hydrocarbon derivative - Organic salt - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as tetraalkyltins. These are tetraorganotin compounds where the tin atom is linked to exactly four alkyl groups. |
| External Descriptors | Not available |
| Molecular Weight | 347.200 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 8 |
| Exact Mass | 348.184 Da |
| Monoisotopic Mass | 348.184 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 146.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |