≥98 atom% D,≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CN(C)C.Cl |
|---|---|
| IUPAC Name | 1,1,1-trideuterio-N,N-bis(trideuteriomethyl)methanamine;hydrochloride |
| InChIKey | SZYJELPVAFJOGJ-KYRNGWDOSA-N |
| INCHI | 1S/C3H9N.ClH/c1-4(2)3;/h1-3H3;1H/i1D3,2D3,3D3; |
| Isomeric SMILES | [2H]C([2H])([2H])N(C([2H])([2H])[2H])C([2H])([2H])[2H].Cl |
| WGK Germany | 3 |
| PubChem CID | 71310292 |
| Molecular Weight | 104.63 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Tertiary amines |
| Direct Parent | Trialkylamines |
| Alternative Parents | Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Tertiary aliphatic amine - Hydrocarbon derivative - Hydrochloride - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as trialkylamines. These are organic compounds containing a trialkylamine group, characterized by exactly three alkyl groups bonded to the amino nitrogen. |
| External Descriptors | Not available |
| Solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
|---|---|
| Sensitivity | Hygroscopic |
| Melt Point(°C) | 283-284 °C (lit.) |
| Molecular Weight | 104.630 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 104.107 Da |
| Monoisotopic Mass | 104.107 Da |
| Topological Polar Surface Area | 3.200 Ų |
| Heavy Atom Count | 5 |
| Formal Charge | 0 |
| Complexity | 8.000 |
| Isotope Atom Count | 9 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
