Determine the necessary mass, volume, or concentration for preparing a solution.
≥90% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CC1=C(C=C2C(=O)C3=CC=CC=C3OC2=N1)C(=O)O |
|---|---|
| IUPAC Name | 2-methyl-5-oxochromeno[2,3-b]pyridine-3-carboxylic acid |
| InChIKey | PFPUNTDSZCGFPG-UHFFFAOYSA-N |
| INCHI | 1S/C14H9NO4/c1-7-9(14(17)18)6-10-12(16)8-4-2-3-5-11(8)19-13(10)15-7/h2-6H,1H3,(H,17,18) |
| Isomeric SMILES | CC1=C(C=C2C(=O)C3=CC=CC=C3OC2=N1)C(=O)O |
| PubChem CID | 1475283 |
| Molecular Weight | 255.23 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Benzopyrans |
| Subclass | 1-benzopyrans |
| Intermediate Tree Nodes | Chromones |
| Direct Parent | Chromeno[2,3-b]pyridine-5-ones |
| Alternative Parents | Chromenopyridines Pyranopyridines Pyridinecarboxylic acids Pyranones and derivatives Methylpyridines Benzenoids Heteroaromatic compounds Azacyclic compounds Oxacyclic compounds Carboxylic acids Monocarboxylic acids and derivatives Organooxygen compounds Hydrocarbon derivatives Organonitrogen compounds Organopnictogen compounds Organic oxides |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Chromeno[2,3-b]pyridine-5-one - Chromenopyridine - Pyranopyridine - Pyridine carboxylic acid - Pyridine carboxylic acid or derivatives - Pyranone - Methylpyridine - Pyran - Pyridine - Benzenoid - Heteroaromatic compound - Carboxylic acid - Carboxylic acid derivative - Monocarboxylic acid or derivatives - Azacycle - Oxacycle - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as chromeno[2,3-b]pyridine-5-ones. These are compounds containing a Chromeno[2,3-b]pyridine moiety that carries an oxo group at the 5-position. |
| External Descriptors | Not available |
| Molecular Weight | 255.220 g/mol |
|---|---|
| XLogP3 | 2.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 255.053 Da |
| Monoisotopic Mass | 255.053 Da |
| Topological Polar Surface Area | 76.500 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 397.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |