Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| ALogP | 0.3 |
|---|
| Canonical Smiles | C1C2=CC=CC=C2C(=O)N(C1=O)CCC(=O)O |
|---|---|
| IUPAC Name | 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid |
| InChIKey | ORZUYKZVLRIJEB-UHFFFAOYSA-N |
| INCHI | 1S/C12H11NO4/c14-10-7-8-3-1-2-4-9(8)12(17)13(10)6-5-11(15)16/h1-4H,5-7H2,(H,15,16) |
| Isomeric SMILES | C1C2=CC=CC=C2C(=O)N(C1=O)CCC(=O)O |
| PubChem CID | 4962537 |
| Molecular Weight | 233.22 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Isoquinolines and derivatives |
| Subclass | 1,3-isoquinolinediones |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 1,3-isoquinolinediones |
| Alternative Parents | Isoquinolones and derivatives Tetrahydroisoquinolines N-substituted carboxylic acid imides Benzenoids Dicarboximides Monocarboxylic acids and derivatives Carboxylic acids Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | 1,3-isoquinolinedione - Isoquinolone - Tetrahydroisoquinoline - Carboxylic acid imide, n-substituted - Benzenoid - Dicarboximide - Carboxylic acid imide - Monocarboxylic acid or derivatives - Carboxylic acid - Carboxylic acid derivative - Azacycle - Organic oxide - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Organic oxygen compound - Carbonyl group - Hydrocarbon derivative - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as 1,3-isoquinolinediones. These are isoquinoline derivatives carrying one C=O group at positions 1, and 3 respectively. |
| External Descriptors | Not available |
| Molecular Weight | 233.220 g/mol |
|---|---|
| XLogP3 | 0.300 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 233.069 Da |
| Monoisotopic Mass | 233.069 Da |
| Topological Polar Surface Area | 74.700 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 352.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |