Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Protected from light,Desiccated Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1(=C(C(=C(C(=C1Br)F)F)Br)N)N |
|---|---|
| IUPAC Name | 3,6-dibromo-4,5-difluorobenzene-1,2-diamine |
| InChIKey | CVQSLVCQGXUJQU-UHFFFAOYSA-N |
| INCHI | 1S/C6H4Br2F2N2/c7-1-3(9)4(10)2(8)6(12)5(1)11/h11-12H2 |
| Isomeric SMILES | C1(=C(C(=C(C(=C1Br)F)F)Br)N)N |
| PubChem CID | 89398323 |
| Molecular Weight | 301.91 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Aniline and substituted anilines |
| Intermediate Tree Nodes | Phenylenediamines |
| Direct Parent | O-phenylenediamines |
| Alternative Parents | 2-bromoanilines Fluorobenzenes Bromobenzenes Aryl fluorides Aryl bromides Primary amines Organofluorides Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | O-phenylenediamine - 2-bromoaniline - Bromobenzene - Fluorobenzene - Halobenzene - Aryl bromide - Aryl fluoride - Aryl halide - Amine - Organohalogen compound - Organobromide - Organofluoride - Organonitrogen compound - Primary amine - Hydrocarbon derivative - Organic nitrogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as o-phenylenediamines. These are aromatic compound containing a benzene ring which carries 2 amino groups, at the 1- and 2-positions. |
| External Descriptors | Not available |
| Sensitivity | light and moisture sensitive |
|---|---|
| Molecular Weight | 301.910 g/mol |
| XLogP3 | 2.100 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 301.869 Da |
| Monoisotopic Mass | 299.871 Da |
| Topological Polar Surface Area | 52.000 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 154.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |