Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C(C(CO)I)C(C(C(F)(F)F)(F)F)(F)F |
|---|---|
| IUPAC Name | 4,4,5,5,6,6,6-heptafluoro-2-iodohexan-1-ol |
| InChIKey | ITASBCIXGRCUAD-UHFFFAOYSA-N |
| INCHI | 1S/C6H6F7IO/c7-4(8,1-3(14)2-15)5(9,10)6(11,12)13/h3,15H,1-2H2 |
| Isomeric SMILES | C(C(CO)I)C(C(C(F)(F)F)(F)F)(F)F |
| PubChem CID | 15019971 |
| Molecular Weight | 354 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Class | Halohydrins |
| Subclass | Iodohydrins |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Iodohydrins |
| Alternative Parents | Primary alcohols Organoiodides Organofluorides Hydrocarbon derivatives Alkyl iodides Alkyl fluorides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Iodohydrin - Organic oxygen compound - Hydrocarbon derivative - Primary alcohol - Organooxygen compound - Organoiodide - Organofluoride - Alkyl iodide - Alkyl halide - Alkyl fluoride - Alcohol - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as iodohydrins. These are alcohols substituted by a iodine atom at a saturated carbon atom otherwise bearing only hydrogen or hydrocarbyl groups. |
| External Descriptors | Not available |
| Molecular Weight | 354.000 g/mol |
|---|---|
| XLogP3 | 3.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 4 |
| Exact Mass | 353.935 Da |
| Monoisotopic Mass | 353.935 Da |
| Topological Polar Surface Area | 20.200 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 214.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |