Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CC1(C2=C(C3=CC=CC=C3N1)C(=S)SS2)C |
|---|---|
| IUPAC Name | 4,4-dimethyl-5H-dithiolo[3,4-c]quinoline-1-thione |
| InChIKey | QAHMULIRAAEXKJ-UHFFFAOYSA-N |
| INCHI | 1S/C12H11NS3/c1-12(2)10-9(11(14)16-15-10)7-5-3-4-6-8(7)13-12/h3-6,13H,1-2H3 |
| Isomeric SMILES | CC1(C2=C(C3=CC=CC=C3N1)C(=S)SS2)C |
| PubChem CID | 3090505 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Secondary amines |
| Direct Parent | Secondary alkylarylamines |
| Alternative Parents | Aralkylamines Benzenoids 1,2-dithiole-3-thiones Heteroaromatic compounds Azacyclic compounds Organosulfur compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Aralkylamine - Secondary aliphatic/aromatic amine - Benzenoid - 1,2-dithiole-3-thione - Heteroaromatic compound - Dithiole - 1,2-dithiole - Azacycle - Organoheterocyclic compound - Hydrocarbon derivative - Organosulfur compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as secondary alkylarylamines. These are secondary alkylarylamines with the general formula HN(R)R' (R = alkyl, R' = aryl). |
| External Descriptors | Not available |
| Molecular Weight | 265.400 g/mol |
|---|---|
| XLogP3 | 3.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 265.005 Da |
| Monoisotopic Mass | 265.005 Da |
| Topological Polar Surface Area | 94.700 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 372.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |