≥97%(GC) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C[Si](C)(C)OC(=O)CC(=O)O[Si](C)(C)C |
|---|---|
| IUPAC Name | bis(trimethylsilyl) propanedioate |
| InChIKey | ATCKJLDGNXGLAO-UHFFFAOYSA-N |
| INCHI | 1S/C9H20O4Si2/c1-14(2,3)12-8(10)7-9(11)13-15(4,5)6/h7H2,1-6H3 |
| Isomeric SMILES | C[Si](C)(C)OC(=O)CC(=O)O[Si](C)(C)C |
| WGK Germany | 3 |
| Molecular Weight | 248.43 |
| Beilstein | 2212120 |
| Reaxy-Rn | 2212115 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2212115&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Class | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Trimethylsilyl esters |
| Alternative Parents | Dicarboxylic acids and derivatives 1,3-dicarbonyl compounds Trialkylheterosilanes Carboxylic acid salts Organic metalloid salts Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Trimethylsilyl ester - 1,3-dicarbonyl compound - Dicarboxylic acid or derivatives - Trialkylheterosilane - Carboxylic acid salt - Organoheterosilane - Organic metalloid salt - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organic salt - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as trimethylsilyl esters. These are organoheterosilanes, bearing a silicon atom that is linked to three methyl groups and is O-esterified. |
| External Descriptors | Not available |
| Sensitivity | Moisture Sensitive,Heat Sensitive |
|---|---|
| Flash Point(°F) | 75.2 °F |
| Flash Point(°C) | 24°C(lit.) |
| Boil Point(°C) | 102°C/15mmHg(lit.) |
| Molecular Weight | 248.420 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 6 |
| Exact Mass | 248.09 Da |
| Monoisotopic Mass | 248.09 Da |
| Topological Polar Surface Area | 52.600 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 224.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
C2525176