Determine the necessary mass, volume, or concentration for preparing a solution.
≥99% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C,Desiccated Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CC(C)(C(=O)N)C(=O)NCCCNC1=NC(=NC=C1Br)NC2=CC(=CC=C2)NC(=O)N3CCCC3 |
|---|---|
| IUPAC Name | N'-[3-[[5-bromo-2-[3-(pyrrolidine-1-carbonylamino)anilino]pyrimidin-4-yl]amino]propyl]-2,2-dimethylpropanediamide |
| InChIKey | ZNSULAZTNWFKEW-UHFFFAOYSA-N |
| INCHI | 1S/C23H31BrN8O3/c1-23(2,19(25)33)20(34)27-10-6-9-26-18-17(24)14-28-21(31-18)29-15-7-5-8-16(13-15)30-22(35)32-11-3-4-12-32/h5,7-8,13-14H,3-4,6,9-12H2,1-2H3,(H2,25,33)(H,27,34)(H,30,35)(H2,26,28,29,31) |
| Isomeric SMILES | CC(C)(C(=O)N)C(=O)NCCCNC1=NC(=NC=C1Br)NC2=CC(=CC=C2)NC(=O)N3CCCC3 |
| Alternate CAS | 702676-93-5 |
| PubChem CID | 657138 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | N-phenylureas |
| Intermediate Tree Nodes | Not available |
| Direct Parent | N-phenylureas |
| Alternative Parents | Aniline and substituted anilines Pyrrolidinecarboxamides Aminopyrimidines and derivatives Secondary alkylarylamines Halopyrimidines Aryl bromides Imidolactams Heteroaromatic compounds Amino acids and derivatives Ureas Secondary carboxylic acid amides Primary carboxylic acid amides Azacyclic compounds Carbonyl compounds Organopnictogen compounds Organobromides Hydrocarbon derivatives Organic oxides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | N-phenylurea - Pyrrolidine carboxylic acid or derivatives - Pyrrolidine-1-carboxamide - Aniline or substituted anilines - Aminopyrimidine - Halopyrimidine - Secondary aliphatic/aromatic amine - Aryl bromide - Aryl halide - Pyrimidine - Imidolactam - Heteroaromatic compound - Pyrrolidine - Secondary carboxylic acid amide - Urea - Primary carboxylic acid amide - Amino acid or derivatives - Carboxamide group - Carbonic acid derivative - Secondary amine - Azacycle - Organoheterocyclic compound - Carboxylic acid derivative - Hydrocarbon derivative - Organohalogen compound - Organopnictogen compound - Organic oxygen compound - Organobromide - Organonitrogen compound - Carbonyl group - Organooxygen compound - Amine - Organic nitrogen compound - Organic oxide - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as n-phenylureas. These are compounds containing a N-phenylurea moiety, which is structurally characterized by a phenyl group linked to one nitrogen atom of a urea group. |
| External Descriptors | organobromine compound - ureas - aminopyrimidine - pyrrolidinecarboxamide |
| Molecular Weight | 547.400 g/mol |
|---|---|
| XLogP3 | 3.000 |
| Hydrogen Bond Donor Count | 5 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 10 |
| Exact Mass | 546.17 Da |
| Monoisotopic Mass | 546.17 Da |
| Topological Polar Surface Area | 154.000 Ų |
| Heavy Atom Count | 35 |
| Formal Charge | 0 |
| Complexity | 734.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |