Determine the necessary mass, volume, or concentration for preparing a solution.
10mM in DMSO for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -80°C Ships Dry ice packs + Cold packs Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 3 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 528769460 |
|---|---|
| Canonical Smiles | CC(=O)OC1=C(C=C(C=C1)CC=C)OC |
| IUPAC Name | (2-methoxy-4-prop-2-enylphenyl) acetate |
| InChIKey | SCCDQYPEOIRVGX-UHFFFAOYSA-N |
| INCHI | 1S/C12H14O3/c1-4-5-10-6-7-11(15-9(2)13)12(8-10)14-3/h4,6-8H,1,5H2,2-3H3 |
| Isomeric SMILES | CC(=O)OC1=C(C=C(C=C1)CC=C)OC |
| WGK Germany | 2 |
| RTECS | SJ4550000 |
| Molecular Weight | 206.24 |
| Beilstein | 6(3)5029 |
| Reaxy-Rn | 1964745 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1964745&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenol esters |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenol esters |
| Alternative Parents | Phenoxy compounds Methoxybenzenes Anisoles Alkyl aryl ethers Carboxylic acid esters Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenol ester - Phenoxy compound - Anisole - Methoxybenzene - Phenol ether - Alkyl aryl ether - Monocyclic benzene moiety - Carboxylic acid ester - Carboxylic acid derivative - Ether - Monocarboxylic acid or derivatives - Organic oxygen compound - Carbonyl group - Hydrocarbon derivative - Organooxygen compound - Organic oxide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenol esters. These are aromatic compounds containing a benzene ring substituted by a hydroxyl group and an ester group. |
| External Descriptors | phenols - benzoate ester |
| Freezing Point(°C) | 26 °C |
|---|---|
| Refractive Index | 1.518 |
| Flash Point(°F) | 287.6 °F - closed cup |
| Flash Point(°C) | 142 °C - closed cup |
| Boil Point(°C) | 281-286°C |
| Melt Point(°C) | 26°C |
| Molecular Weight | 206.240 g/mol |
| XLogP3 | 2.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 5 |
| Exact Mass | 206.094 Da |
| Monoisotopic Mass | 206.094 Da |
| Topological Polar Surface Area | 35.500 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 225.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Zujin Yang, Guifang Wu, Cui Gan, Guangmei Cai, Jianyong Zhang, Hongbing Ji. (2021) Effective adsorption of arsenate, dyes and eugenol from aqueous solutions by cationic supramolecular gel materials. COLLOIDS AND SURFACES A-PHYSICOCHEMICAL AND ENGINEERING ASPECTS, [PMID:] [10.1016/j.colsurfa.2021.126238] |
| 2. Tian Bao-liang, Liu Qi-Zhi, Liu Zhi-Long, Li Peng, Wang Jie-Wen. (2015) Insecticidal Potential of Clove Essential Oil and Its Constituents on Cacopsylla chinensis (Hemiptera: Psyllidae) in Laboratory and Field. JOURNAL OF ECONOMIC ENTOMOLOGY, 108 (3): (957-961). [PMID:26470216] [10.1093/jee/tov075] |
| 3. Liqiu Chen, Ran Zhang, Jing Xiao, Ying Liang, Zhen Lan, Yingao Fan, Xi Yu, Shengnan Xia, Haiyan Yang, Xinyu Bao, Hailan Meng, Yun Xu, Linjie Yu, Xiaolei Zhu. (2025) Neuroprotective Effects of Eugenol Acetate Against Ischemic Stroke. Journal of Inflammation Research, [PMID:39802508] [10.2147/JIR.S487482] |