Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Information
GSK2643943A is an inhibitor ofdeubiquitylating enzyme (DUB)with IC50 of 160 nM forUSP20/Ub-Rho.
Targets
USP20/Ub-Rho (Cell-free assay) 160 nM
| ALogP | 3.571 |
|---|---|
| HBD Count | 2 |
| Rotatable Bond | 2 |
| Pubchem Sid | 504773490 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504773490 |
| Canonical Smiles | C1=CC(=CC(=C1)F)C=CC2=CC3=C(C=C2)C(=C(N3)N)C#N |
| IUPAC Name | 2-amino-6-[(E)-2-(3-fluorophenyl)ethenyl]-1H-indole-3-carbonitrile |
| InChIKey | CGXBPMZRTMXEIA-SNAWJCMRSA-N |
| INCHI | 1S/C17H12FN3/c18-13-3-1-2-11(8-13)4-5-12-6-7-14-15(10-19)17(20)21-16(14)9-12/h1-9,21H,20H2/b5-4+ |
| Molecular Weight | 277.3 |
| Reaxy-Rn | 38910864 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=38910864&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →| Solubility | Solubility (25°C) In vitro DMSO: 55 mg/mL (198.34 mM); Ethanol: 8 mg/mL (28.84 mM); Water: Insoluble; |
|---|---|
| DMSO(mg / mL) Max Solubility | 55 |
| DMSO(mM) Max Solubility | 198.341146772449 |
| Water(mg / mL) Max Solubility | <1 |
| Molecular Weight | 277.290 g/mol |
| XLogP3 | 4.300 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 277.102 Da |
| Monoisotopic Mass | 277.102 Da |
| Topological Polar Surface Area | 65.600 Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 441.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 1 |
| Covalently-Bonded Unit Count | 1 |