Application：
L-Dihydroorotic acid has been used as a substrate in dihydroorotate dehydrogenase (DHODH) assay.
| Canonical Smiles | C1C(NC(=O)NC1=O)C(=O)O |
|---|---|
| IUPAC Name | (4S)-2,6-dioxo-1,3-diazinane-4-carboxylic acid |
| InChIKey | UFIVEPVSAGBUSI-REOHCLBHSA-N |
| INCHI | 1S/C5H6N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h2H,1H2,(H,9,10)(H2,6,7,8,11)/t2-/m0/s1 |
| Isomeric SMILES | C1[C@H](NC(=O)NC1=O)C(=O)O |
| WGK Germany | 3 |
| Molecular Weight | 158.11 |
| Reaxy-Rn | 83959 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=83959&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives |
| Direct Parent | Alpha amino acids and derivatives |
| Alternative Parents | Pyrimidones N-acyl ureas Diazinanes Dicarboximides Monocarboxylic acids and derivatives Carboxylic acids Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Alpha-amino acid or derivatives - N-acyl urea - Pyrimidone - Ureide - 1,3-diazinane - Pyrimidine - Dicarboximide - Urea - Carbonic acid derivative - Azacycle - Monocarboxylic acid or derivatives - Carboxylic acid - Organoheterocyclic compound - Hydrocarbon derivative - Organic oxide - Organooxygen compound - Organonitrogen compound - Organopnictogen compound - Organic oxygen compound - Carbonyl group - Organic nitrogen compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof. |
| External Descriptors | dihydroorotic acid |
| Melt Point(°C) | 254-255°C |
|---|---|
| Molecular Weight | 158.110 g/mol |
| XLogP3 | -1.500 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 158.033 Da |
| Monoisotopic Mass | 158.033 Da |
| Topological Polar Surface Area | 95.500 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 225.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Yiming Liu, Mingrui Zhang, Jingjing Zhao, Yongshuo Ren, Shubin Li, Weichen Wang, Wei Mu, Xiaojun Han. (2025) Construction of a De Novo Nucleotide Biosynthesis Pathway in Artificial Cells for RNA Transcription. Journal of the American Chemical Society, [PMID:40708544] [10.1021/jacs.5c09375] |
