Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CC1=CC(=[N+](C=C1)F)S(=O)(=O)[O-] |
|---|---|
| IUPAC Name | 1-fluoro-4-methylpyridin-1-ium-2-sulfonate |
| InChIKey | CZLMNRIAOUVXNU-UHFFFAOYSA-N |
| INCHI | 1S/C6H6FNO3S/c1-5-2-3-8(7)6(4-5)12(9,10)11/h2-4H,1H3 |
| Isomeric SMILES | CC1=CC(=[N+](C=C1)F)S(=O)(=O)[O-] |
| PubChem CID | 2737404 |
| Molecular Weight | 191.18 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Organic sulfonic acids and derivatives |
| Subclass | Organosulfonic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Arylsulfonic acids and derivatives |
| Alternative Parents | Methylpyridines Pyridinium derivatives Sulfonyls Organosulfonic acids Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic zwitterions Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Arylsulfonic acid or derivatives - Methylpyridine - Pyridine - Pyridinium - Heteroaromatic compound - Sulfonyl - Organosulfonic acid - Azacycle - Organoheterocyclic compound - Organic oxygen compound - Hydrocarbon derivative - Organic zwitterion - Organic nitrogen compound - Organosulfur compound - Organonitrogen compound - Organic oxide - Organopnictogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as arylsulfonic acids and derivatives. These are organic compounds containing an aryl group attached to the sulfonic acid group (or a derivative thereof). |
| External Descriptors | Not available |
| Melt Point(°C) | 203-208°(dec.) |
|---|---|
| Molecular Weight | 191.180 g/mol |
| XLogP3 | 0.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 191.005 Da |
| Monoisotopic Mass | 191.005 Da |
| Topological Polar Surface Area | 69.500 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 235.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |