Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C[Si](C)(C1=CC=CO1)[O-].[Na+] |
|---|---|
| IUPAC Name | sodium;furan-2-yl-dimethyl-oxidosilane |
| InChIKey | LZJRCLPTAZMQQW-UHFFFAOYSA-N |
| INCHI | 1S/C6H9O2Si.Na/c1-9(2,7)6-4-3-5-8-6;/h3-5H,1-2H3;/q-1;+1 |
| Isomeric SMILES | C[Si](C)(C1=CC=CO1)[O-].[Na+] |
| WGK Germany | 3 |
| PubChem CID | 23693090 |
| Molecular Weight | 164.21 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Class | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkylarylsilanes |
| Alternative Parents | Heteroaromatic compounds Furans Oxacyclic compounds Organoheterosilanes Organic metalloid salts Organooxygen compounds Organic zwitterions Organic sodium salts Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Alkylarylsilane - Furan - Heteroaromatic compound - Organoheterosilane - Organoheterocyclic compound - Oxacycle - Organic alkali metal salt - Organic metalloid salt - Organic oxygen compound - Organic sodium salt - Hydrocarbon derivative - Organic salt - Organic zwitterion - Organic oxide - Organooxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkylarylsilanes. These are organosilicon compounds with the general formula R[Si]R' (R = alkyl, R' = aryl). |
| External Descriptors | Not available |
| Molecular Weight | 164.210 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 164.027 Da |
| Monoisotopic Mass | 164.027 Da |
| Topological Polar Surface Area | 36.200 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 108.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |