Determine the necessary mass, volume, or concentration for preparing a solution.
≥99% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Protected from light Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CC(=NNC(=S)N)C1=CC=CS1 |
|---|---|
| IUPAC Name | [(Z)-1-thiophen-2-ylethylideneamino]thiourea |
| InChIKey | PJVHAJJEMJNPHN-UITAMQMPSA-N |
| INCHI | 1S/C7H9N3S2/c1-5(9-10-7(8)11)6-3-2-4-12-6/h2-4H,1H3,(H3,8,10,11)/b9-5- |
| Isomeric SMILES | C/C(=N/NC(=S)N)/C1=CC=CS1 |
| PubChem CID | 5375570 |
| MeSH Entry Terms | ((Z)-1-thiophen-2-ylethylideneamino)thiourea;SSAA09E1 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Hydrazines and derivatives |
| Intermediate Tree Nodes | Thiosemicarbazides |
| Direct Parent | Thiosemicarbazones |
| Alternative Parents | Thiophenes Heteroaromatic compounds Organosulfur compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Thiosemicarbazone - Heteroaromatic compound - Thiophene - Organoheterocyclic compound - Hydrocarbon derivative - Organosulfur compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as thiosemicarbazones. These are compounds containing the thiosemicarbazone functional group obtained by replacing the carbonyl group by a thiocarbonyl group. |
| External Descriptors | Not available |
| Molecular Weight | 199.300 g/mol |
|---|---|
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 199.024 Da |
| Monoisotopic Mass | 199.024 Da |
| Topological Polar Surface Area | 111.000 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 203.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 1 |
| Covalently-Bonded Unit Count | 1 |