Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CCC1CCC(P1CCP2C(CCC2CC)CC)CC |
|---|---|
| IUPAC Name | (2R,5R)-1-[2-[(2R,5R)-2,5-diethylphospholan-1-yl]ethyl]-2,5-diethylphospholane |
| InChIKey | QOLRLVPABLMMKI-BRSBDYLESA-N |
| INCHI | 1S/C18H36P2/c1-5-15-9-10-16(6-2)19(15)13-14-20-17(7-3)11-12-18(20)8-4/h15-18H,5-14H2,1-4H3/t15-,16-,17-,18-/m1/s1 |
| Isomeric SMILES | CC[C@@H]1CC[C@H](P1CCP2[C@@H](CC[C@H]2CC)CC)CC |
| WGK Germany | 3 |
| Molecular Weight | 314.43 |
| Reaxy-Rn | 14550098 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=14550098&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Metalloheterocyclic compounds |
| Subclass | Phospholanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phospholanes |
| Alternative Parents | Organic phosphines and derivatives Phosphacyclic compounds Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Phospholane - Phosphine - Phosphacycle - Organopnictogen compound - Hydrocarbon derivative - Organophosphorus compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phospholanes. These are compounds containing a phospholane ring, which is a five-member saturated aliphatic heterocycle with one phosphorus atom and four carbon atoms. |
| External Descriptors | Not available |
| Sensitivity | air sensitive |
|---|---|
| Molecular Weight | 314.400 g/mol |
| XLogP3 | 4.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 7 |
| Exact Mass | 314.229 Da |
| Monoisotopic Mass | 314.229 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 227.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |