Determine the necessary mass, volume, or concentration for preparing a solution.
≥90% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1CN2CCC1C(=O)C2=CC3=CC=CO3 |
|---|---|
| IUPAC Name | (2E)-2-(furan-2-ylmethylidene)-1-azabicyclo[2.2.2]octan-3-one |
| InChIKey | HNLJEHXLQINNQQ-DHZHZOJOSA-N |
| INCHI | 1S/C12H13NO2/c14-12-9-3-5-13(6-4-9)11(12)8-10-2-1-7-15-10/h1-2,7-9H,3-6H2/b11-8+ |
| Isomeric SMILES | C1CN\2CCC1C(=O)/C2=C\C3=CC=CO3 |
| PubChem CID | 700274 |
| Molecular Weight | 203.24 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Quinuclidines |
| Subclass | Quinuclidones |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Quinuclidones |
| Alternative Parents | Piperidinones Heteroaromatic compounds Furans Trialkylamines Ketones Oxacyclic compounds Enamines Azacyclic compounds Organopnictogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Quinuclidone - Piperidinone - Piperidine - Furan - Heteroaromatic compound - Tertiary aliphatic amine - Tertiary amine - Ketone - Oxacycle - Azacycle - Enamine - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Amine - Carbonyl group - Hydrocarbon derivative - Organic oxide - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as quinuclidones. These are compounds containing a quinuclidine moiety which bears a ketone group. |
| External Descriptors | Not available |
| Molecular Weight | 203.240 g/mol |
|---|---|
| XLogP3 | 1.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 203.095 Da |
| Monoisotopic Mass | 203.095 Da |
| Topological Polar Surface Area | 33.500 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 303.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 1 |
| Covalently-Bonded Unit Count | 1 |