Determine the necessary mass, volume, or concentration for preparing a solution.
≥99.995% metals basis for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 3 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | [NH4+].[NH4+].Cl[Pt-2](Cl)(Cl)(Cl)(Cl)Cl |
|---|---|
| IUPAC Name | diazanium;hexachloroplatinum(2-) |
| InChIKey | PCCGQTHFYHJATL-UHFFFAOYSA-J |
| INCHI | 1S/6ClH.2H3N.Pt/h6*1H;2*1H3;/q;;;;;;;;+4/p-4 |
| Isomeric SMILES | [NH4+].[NH4+].Cl[Pt-2](Cl)(Cl)(Cl)(Cl)Cl |
| WGK Germany | 1 |
| RTECS | BP5425000 |
| PubChem CID | 16211460 |
| UN Number | 3288 |
| Molecular Weight | 443.87 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Inorganic compounds |
|---|---|
| Superclass | Mixed metal/non-metal compounds |
| Class | Transition metal salts |
| Subclass | Transition metal chlorides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Transition metal chlorides |
| Alternative Parents | Inorganic chloride salts |
| Molecular Framework | Not available |
| Substituents | Transition metal chloride - Inorganic chloride salt - Inorganic salt |
| Description | This compound belongs to the class of inorganic compounds known as transition metal chlorides. These are inorganic compounds in which the largest halogen atom is Chlorine, and the heaviest metal atom is a transition metal. |
| External Descriptors | ammonium salt |
| Sensitivity | Hygroscopic |
|---|---|
| Molecular Weight | 443.900 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 442.844 Da |
| Monoisotopic Mass | 440.847 Da |
| Topological Polar Surface Area | 2.000 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 62.700 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |
| 1. Haoxi Jiang, Zhonghua Liu, Chuanxu Yao, Sheng Wang. (2022) Preparation of highly dispersed Pt/Hβ catalyst via supercritical fluid deposition and its catalytic performance for combustion of toluene. MICROPOROUS AND MESOPOROUS MATERIALS, [PMID:] [10.1016/j.micromeso.2022.111842] |
| 2. Peipei Zhang, Yibo Hu, Baihai Li, Qiuju Zhang, Chen Zhou, Hongbo Yu, Xuejun Zhang, Liang Chen, Bryan Eichhorn, Shenghu Zhou. (2015) Kinetically Stabilized Pd@Pt Core–Shell Octahedral Nanoparticles with Thin Pt Layers for Enhanced Catalytic Hydrogenation Performance. ACS Catalysis, [PMID:] [10.1021/cs501612g] |
| 3. Yue Wu, Cailing Chen, Zhuo Xiong, Meng Xu, Yue Zhao, Yihu Dai, Yu Han, Yu Zhou, Xiaoling Liu, Jun Wang. (2024) Metal-acid synergistic catalysis accelerates the hydrogen borrowing amination of alcohols by confining Ru sites in Beta zeolite. CHEMICAL ENGINEERING JOURNAL, [PMID:] [10.1016/j.cej.2024.152457] |